A cereal company is putting 1 11 of 4 44 prizes in each box of cereal. The prizes are evenly distributed so the probability of winning any given prize is always 1 / 4 1/41, slash, 4.

Answers

Answer 1

Answer:

0.75

Step-by-step explanation:

The complete question is attached below.

The dots on the numbers of the dot plot represent the number of boxes it took Vera to get all the prizes.

Therefore, the probability of getting all the prizes in 9 or fewer boxes is the sum of the number of times it took her to get 4 prizes in 9 boxes or fewer.

Hence:

P(x ≤ 9) = P(x = 4) + P(x = 5) + P(x = 6) + P(x = 7) + P(x = 8) + P(x =9)

P(x ≤ 9) = (4 / 36) + (6 / 36) + (3 / 36) + (4 / 36) + (4 / 36) + (6 / 36)

P(x ≤ 9) = 27 / 36

P(x ≤ 9) = 3 / 4 = 0.75

A Cereal Company Is Putting 1 11 Of 4 44 Prizes In Each Box Of Cereal. The Prizes Are Evenly Distributed

Related Questions

What is the interval notation for the compound inequality? x≤−4 or x≥5
(−∞, −4) or (5, ∞)
(−∞, −4] or [5, ∞)
(−4,5)
[−4,5]

Answers

Answer:

(-∞, -4] or [5, ∞)

Step-by-step explanation:

Because the solutions for x can also be equal to -4 and 5, brackets are used.

And because the solutions for x can be any number less than -4 or any number greater than 5, -∞ and ∞ are used respectively.

A line is perpendicular to y = 3x - 8
and intersects the point (2,2).
What is the equation of this
perpendicular line?

Answers

Since the line is perpendicular, we know that the slope is reciprocal and negative to the other one.

So,

y = -4x + b

We want to find the y-intersect (b) so substitute the intersected points and solve for it.

2 = -4(2) + b

2 = -8 + b

2 + 8 = b

10 = b

So the complete equation would be:

y = -4x + 10

Express 0.000000000936 in
scientific notation.
9.36x10
Enter

Answers

Answer:

9.36 x 10^(-10)

Step-by-step explanation:

PLEASE HELP ASSP !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!

Answers

Answer:

A: 2/9

Step-by-step explanation:

think of an event that might occur at three different speeds and describe it.

Answers

Answer:

tornado!

Step-by-step explanation:

sometimes tornados can start off slow and sometimes they can go really fast.

A ball is thrown upward at an angle of 30° to the horizontal and lands on the top edge of a building that is 20 m away. The top edge is 5.0 m above the throwing point. How fast was the ball thrown? Use: sin30°=0.5 and cos30°=0.9
a. 20 m/s
b. 11 m/s
c. 52.3 m/s
d. 16 m/s​

Answers

Answer:

The correct option is;

a. 20 m/s

Step-by-step explanation:

The given parameters are;

The angle at which the ball is thrown, θ = 30° to the horizontal

The horizontal distance of the top edge of the building where the ball lands from where the ball is thrown, x = 20 m

The height of the top edge of the building above the throwing point = 5 meters

Let "v" represent the speed with which the ball is thrown

We have;

The vertical component of the speed with which the ball is thrown, [tex]v_y[/tex] = v × sin(θ) = v × sin(30°) = v × 0.5 = 0.5·v

[tex]v_y[/tex] = 0.5·v

The horizontal component of the speed with which the ball is thrown, vₓ = v × cos(θ) = v × cos(30°) = v × 0.9 = 0.9·v

vₓ = 0.9·v

The kinematic equation of the motion is y = [tex]v_y[/tex]·t - (1/2)·g·t², where;

y = The vertical height reached = 5 metes

t = The time taken to reach the specified 5 m, height

g = The acceleration due to gravity = 9.8 m/s², we have;

Therefore, we have;

5 = 0.5·v·t - (1/2)·9.8·t²...(1)

Also, from the horizontal motion of the ball, we have the following kinematic equation of motion;

x = vₓ × t

Therefore, by substituting the known values, we have;

20 = 0.9·v × t

∴ v = 20/(0.9·t) = 200/(9·t)...(2)

Substituting the value of t in equation (1) gives;

5 = 0.5·v·t - (1/2)·9.8·t² = 0.5·(200/(9·t))·t - (1/2)·9.8·t²

∴ 5 = 0.5·(200/(9·t))·t - (1/2)·9.8·t² = 100/9 - 4.9·t²

4.9·t² = 100/9 - 5 = 55/9

t = √(55/(9 × 4.9)) ≈ 1.116766

The time taken to reach the specified 5 m height = t ≈ 1.116766 seconds

From equation (2), we have, v = 200/(9·t) = 200/(9 × 1.116766) ≈ 19.8987 m/s

The speed with which the ball is thrown = v ≈ 19.8987 m/s ≈ 20 m/s. to the nearest whole number.

The speed with which the ball is thrown is approximately 20 m/s

Answer:

The answer is:

a) 20 m/s

Hope it helps:D

Suppose you know that the volume of the following prism is represent by V(x) = -2x^3 + 14x^2 + 120x.

Answers

Step-by-step explanation:

-2x³ + 14x² + 120x

= -2x(x² - 7x - 60)

= -2x(x - 12)(x + 5).

The other 2 dimensions are -2x and (x + 5).

When using a graphing calculator to maximise the volume of the prism, we get x = 7.378. However this value is not reasonable as it makes -2x and (x - 12) negative, which are the sides of the prism.

|-4/5-1/10| + |-3/4+5/2|

A.) 9/10
B.) 53/20
C.) 7/4
D.) 17/10​

Answers

Answer:

B.) 53/20

General Formulas and Concepts:

Pre-Algebra

Order of Operations: BPEMDAS

Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to Right

Algebra I

|Absolute Value| makes any negative number positive

Step-by-step explanation:

Step 1: Define

|-4/5 - 1/10| + |-3/4 + 5/2|

Step 2: Evaluate

Subtract:                    |-9/10| + |-3/4 + 5/2|Add:                           |-9/10| + |7/4|Absolute Value:        9/10 + 7/4Add:                           53/20

Kira is on her way home in her car. Her drive is 30 miles long. She has finished one-third of the drive so far. How far has she driven?

Answers

Answer:

10 miles

Step-by-step explanation:

1/3 × 30 miles = 10 miles

Answer:

Step-by-step explanation:

30 * 1/3 = 10  :)

Help me on this math problem please! I’ve been stuck on it for 15 mins now

Answers

Answer:

Step-by-step explanation:

P = perimeter = 114

P =2 * length +2* width

P = 2(2x - 3) + 2(x)

114 =  4x-6  + 2x

114 = 6x -6

19 = x -1

20 = x

check it  

2( 2x -3)+2x =  ?  

4x -6 +2x=?

6x -6 = ?

6(20)-6 =?

120-6 = 114

yep this is correct

help!!

Find the solution of the system of equations
shown on the graph.

Answers

Answer:

(0,6)

Step-by-step explanation:

When a system of equations is graphed, the point at which the lines intersect is a solution to the system. Looking at the graph, we can see that the lines intersect at (0,6). Therefore, (0,6) is a solution to the system of equations.

In the figure, point C is the midpoint of (A/E) Use the figure to answer the questions.

Avery says that AbC /DeC by the ASA congruence postulate. Do you agree or disagree Explain?
Suppose it is also known that point C is also the midpoint of (B/D Which postulate or theorem can be used to prove that aBC/DeC? Justify your answer.

Answers

Answer:

Disagree ΔABC ≅ ΔDEC by ASA butt by SAS

Step-by-step explanation:

point C is the midpoint of (A/E), C is also the midpoint of (B/D )

BC = CD   and AC = CE

∠BCA = ∠ECD

ΔABC ≅ ΔDEC by SAS not by ASA

TRAVEL It is about 350 miles from Ruidoso, New Mexico, to Abilene, Texas. Haruko has already driven 75 miles and made it to Roswell, New Mexico. She hopes to finish the rest of her trip, including stops, in 5 hours. Write an equation to find the average speed Haruko needs to drive to finish the rest of her trip in 5 hours.

Answers

Answer:

55 mph

Step-by-step explanation:

Given that:

Total miles of journey = 350 miles

Miles already driven = 75 miles

To cover the rest of the journey in 5 hours, the average speed of travel. Will be:

Recall:

Speed = (Distance left to cover ÷ budgeted travel time)

Distance left to cover : (total miles - distance already driven)

Average speed required = (350 - 75) / 5

= 275 / 5

= 55 mph

What is the expression shown

Answers

Answer:

There is nothing but your question and you should try on your own

Step-by-step explanation:

Answer:

N/A

Step-by-step explanation:

There is not context with this problem, therefore it cannot be solved.

Explain how to create an equation with infinity many solutions.

Answers

Make the equations have the same value
Example: 2(x+3) = 2x + 6

you need both sides of the equation to be equal to each other.

ex: 1 = 1

x = x

10 - x = -x + 10

this may not be what you're looking for and if it isn't just let me know

How many solutions exist for the given equation?
1/2(x+12) = 4x - 1

Zero
One
Two
Infinitely many

Answers

Answer:

1

Step-by-step explanation:

Answer:

One

Step-by-step explanation:

[tex] \frac{1}{2} (x +12) = 4x - 1 \\ \\ \frac{1}{2} x + \frac{1}{2} \times 12 = 4x - 1 \\ \\ \frac{1}{2} x + 6 = 4x - 1 \\ \\ 6 + 1 = 4x - \frac{1}{2} x \\ \\ 7 = \frac{8x - x}{2} \\ \\ 7 = \frac{7}{2} x \\ \\ 7 \times 2 = 7x \\ \\ x = \frac{7 \times 2}{7} \\ \\ x = 2[/tex]

So, there exist only one solution for the given equation.

Here are two rectangles.

Complete this sentence:

The two rectangles are similar and the scale factor is __

Answers

Answer:

It is

Scale Factor = Ratio of Side Lengths

= 12/8 = 9/6 = 1.5.

Step-by-step explanation:

Hope this helped have an amazing day!

The two rectangles are similar and the scale factor is 3/2.

Given data:

The first rectangle is represented as ABCD

The second rectangle is represented as PQRS

Now, the dimensions of ABCD is 8 cm x 6 cm

The dimensions of PQRS is 12 cm x 9 cm

So, the scale factor is represented as k and the value of k is :

k = length of PQRS / length of ABCD

So, k = 12 / 8

k = 3/2

Hence , the similar rectangles have a scale factor of 3/2

To learn more about rectangle click :

https://brainly.com/question/15225905

#SPJ2

What is 5 billion times 0

Answers

Answer:

0

Step-by-step explanation:

Anything multiplied by 0 is 0

PLEASE HELPP
What is the solution to the following system of equations?

x − 3y = 6
2x + 2y = 4

(-1, 3)
(3, -1)
(1, -3)
(-3, 1)

Answers

Answer:

The solution to the system of equations be:

[tex]x=3,\:y=-1[/tex]

Hece, option B is correct.

Step-by-step explanation:

Given the system of equations

[tex]\begin{bmatrix}x-3y=6\\ 2x+2y=4\end{bmatrix}[/tex]

Multiply x − 3y = 6 by 2:      2x-6y=12

[tex]\begin{bmatrix}2x-6y=12\\ 2x+2y=4\end{bmatrix}[/tex]

so

[tex]2x+2y=4[/tex]

[tex]-[/tex]

[tex]\underline{2x-6y=12}[/tex]

[tex]8y=-8[/tex]

so the system of equations becomes

[tex]\begin{bmatrix}2x-6y=12\\ 8y=-8\end{bmatrix}[/tex]

Solve 8y = -8 for y

[tex]8y=-8[/tex]

Divide both sides by 8

[tex]\frac{8y}{8}=\frac{-8}{8}[/tex]

[tex]y=-1[/tex]

[tex]\mathrm{For\:}2x-6y=12\mathrm{\:plug\:in\:}y=-1[/tex]

[tex]2x-6\left(-1\right)=12[/tex]

[tex]2x+6=12[/tex]

subtract 6 from both sides

[tex]2x+6-6=12-6[/tex]

[tex]2x=6[/tex]

Divide both sides by 2

[tex]\frac{2x}{2}=\frac{6}{2}[/tex]

[tex]x=3[/tex]

Therefore, the solution to the system of equations be:

[tex]x=3,\:y=-1[/tex]

Hence, option B is correct.

A N S W E R :

x - 3y = 6 ......[Equation (i) ]2x + 2y = 4 ......[Equation (ii)]

⚽ From Equation (i) we get :

x = 6 + 3y......[Equation (iii)]

⚽ Now, Substitute the equation (iii) in equation (ii) we get :

→ 2(6 + 3y) + 2y = 4

→ 12 + 6y + 2y = 4

→ 8y = 4 - 12

→ 8y = -8

→ y = -8 ÷ 8

y = -1

⚽ Now Substituting value of y = -1 in equation (iii) we get :

→ x = 6 + 3y

→ x = 6 + 3(-1)

→ x = 6 + (-3)

→ x = 6 - 3

x = 3

Hence,the value of x = 3 and value of y = -1.

A classroom is 11 m long, 8 m wide and 5.5 m high Find the sum of the areas of the four walls.
( please show the working out pleaseee)​

Answers

Answer:

209 m²

Step-by-step explanation:

The class room has a measurement of 11 m long, 8 m wide and 5.5 m high. Hence the walls of the classroom would be 4, with the following measurements.

Wall 1: 11 m by 5.5 m, Wall 2: 8 m by 5.5 m, Wall 3: 11 m by 5.5 m and Wall 4: 8 m by 5.5 m

The area of wall 1 = 11 m * 5.5 m = 60.5 m²

The area of wall 2 = 8 m * 5.5 m = 44 m²

The area of wall 3 = 11 m * 5.5 m = 60.5 m²

The area of wall 4 = 11 m * 5.5 m = 44 m²

The sum of areas of the fall wall = area of wall 1 + area of wall 2 + area of wall 3 + area of wall 4

The sum of areas of the fall wall = 60.5 + 44 + 60.5 + 44 = 209 m²

3/7 to its decimal form and rounded to the nearest thousandth

Answers

Answer:

Decimal form: 0.4286

Step-by-step explanation:

The value of 3/7 in decimal form up to nearest thousands will be 0.4285.

A fraction 3/7 is given in the question.

We have to find it's decimal form and round-off it to nearest thousands.

What will be the value of 1/2 in decimal form rounded to units place ?

The value will be 0.5

To find the decimal form let's divide 3 by 7.

3 ÷ 7 = 0.428572

We have to round it to nearest thousands i.e., up to 4 places Right to decimal point.

The rounded value will be 0.4285.

thus , the decimal form of 3/7 will be 0.4285 rounded off to nearest thousands.

To learn more about how to convert fraction to decimal click here ;

https://brainly.com/question/13635105

#SPJ2

BC = 17.89
DC = 16
with reference to the figure sin x=?
a.0.250
b. 0.447
c.0.894
d. 1

Answers

Answer:

c

Step-by-step explanation:

The value of sin x in the given right triangle is 0.894.

What sine of an angle?

The sine of an angle is a trigonometric function that is defined as the ratio of the length of the side opposite the angle to the length of the hypotenuse in a right triangle.

Given is right triangle ABC, we need to find the value of sin x,

So, we see that the figure is divided into three similar triangles,

Namely,

Δ CDB ~ Δ BDA ~ Δ CBA,

Therefore, according to the definition of similarity,

We have,

CD / CB = BD / BA = 16/17.89

Therefore, BD / BA = 0.894

Also,

sin x = BD / BA

Therefore,

sin x = 0.894

Hence the value of sin x in the given right triangle is 0.894.

Learn more about sine of an angle, click;

https://brainly.com/question/3827723

#SPJ7

the diagram shows two parallel lines cut by a transversal. If the measure of < 3 = ( 7y + 15) and the measure of < 5 = ( 110 - 2y) , what is the measure of <4​

Answers

Step-by-step explanation:

Angle 3 + Angle 5 = 180° (C-angles)

Therefore 7y + 15 + 110 - 2y = 180, 5y = 55, y = 11.

Angle 4 = Angle 5 (Z-angles)

Hence Angle 4 = 110 - 2y = 110 - 2(11) = 88°.

Work out the Value of the missing fraction 1/7+ ?=1/3

Answers

Step-by-step explanation:

1/7 + ? = 1/3

? = 1/3 - 1/7 = 7/21 - 3/21 = 4/21.

The missing fraction is 4/21.

Answer Plz, ASAP. Within 10 minutes will be Marked as Brainliest ​

Answers

[tex]\large\bold{\underline{\underline{To \: Find:-}}}[/tex]

[tex] \sf \left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right|=?[/tex]

[tex]\large\bold{\underline{\underline{Explanation:-}}}[/tex]

They are asking us to find the determinant

[tex]\boxed{\sf \left|\begin{array}{c c} a & b \\ c & d \end{array}\right| =ad-bc}[/tex]

Now using the above formula it becomes

[tex]\left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right| \: = sin20 \degree cos70 \degree - ( - cos20 \degree sin70 \degree) \: \\ \\ = sin20 \degree cos70 \degree + cos20 \degree sin70 \degree [/tex]

Now using the formula

[tex]\boxed{\sf sin(A+B)=sinAcosB+cosAsinB}[/tex]

it becomes

[tex] \longrightarrow \: sin(20 + 70) \\ \\ \longrightarrow \: sin(90 \degree) = 1[/tex]

★Therefore

[tex] \boxed{\sf \left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right|=1}[/tex]

━━━━━━━━━━━━━━━━━━━

★Extra information:-

What is a matrix?

☄It is a rectangular representation or array of numbers,symbols and many more functions

☄It is represented in rows and columns

━━━━━━━━━━━━━━━━━━━━━━━━━━

1) Graph the quadratic function given in standard form and identify the key features. Include at least 5 points on your
graph.
y=-x²-2x +1
Axis of Symmetry:
Vertex:
Y-intercept:
Domain:
Range:
Just question one plz help ASAP

Answers

Answer:

14

Step-by-step explanation:

Explain it too and is it x method?

Answers

Look when I factored this question I got 4(x+6)(x-8)
So Iam not sure either what the correct answer is but that’s what I got

Solve.
y= 2x - 6
4x – 2y = 14
Use the substitution method.

Answers

Answer:

y=2x-6. ---------(1)

4x-2y=14. --------(2)

substituting equation 2 in 1

4x-2(2x-6)=14

4x-4x+12=14

so it has no solution

Step-by-step explanation:

As you can see in the image below, the answer is no solution.

Have no idea how to do this lok

Answers

Answer:

that hard

Step-by-step explanation:

PLEASE HELP
f(x) = x2. What is g(x)?

Answers

Answer: Choice C.  g(x) = (3x)^2

To confirm this, plug in x = 1 and you'll find that:

g(x) = (3x)^2

g(1) = (3*1)^2

g(1) = (3)^2

g(1) = 3*3

g(1) = 9

Showing that (1,9) is on the red g(x) curve.

Other Questions
PLEASE ANSWER ASASP FOR BRAINLEST!!!!!!!!!!!The number of blood donors at an annual drive increased this year by 20% from last year. If there were d donors last year, write two different expressions for the number of donors this year. Select all that apply A. 1.20dB. d+0.20dC. d - 0.20dD. 0.80d Why do adults make bigger splashes when they jump into swimming pools than small children? What is 78.74 rounded to the nearest tenth When we compare two fractions with the same numerator, whichstatement below is true?The fractions with the samenumerators are the same.11The fraction with the smallerdenominator is the larger fraction.CThe fraction with the largerdenominator is the larger fraction.D.We cannot say which is larger orsmaller than the other. A large online credit card hack involving multiple financial institutions resulted in the loss of billions of dollars. Which type of forensics would likely be called to investigate the case?A) Forensic entomologyB) Digital forensicsC) Forensic odontologyD) Forensic pathology PromptWrite a paragraph detailing a common ritual in American culture similar to the Nacirema example. What do we do that anthropologists might find strange or unusual? What lessons did Mehmat learn from his mistakes? How does photosynthesis start? I need help with 13 and 13. Fill in the correct form for the verb in parenthesis using the preterite tense Pablo Picasso obtained a loan of $2,400 to install a new roof on his home. The interest rate is 12% and the monthly payment is $113.04. What is the interest on the first monthly payment?A) $24.00B) $25.04C) $29.90D) $32.01 let Xi; i=1,2....,n from distribution with p.d.f , f(x) = x^-1, 0 Write an equation to represent this word problem. You do not need to solve.2 less than 7 times a number is equal to 4 more than 8 times the number. Tel ganador.O a. fuimosOb. fuisteOc. eramosO d. fue New Ventures Enterprises Inc. Is considering a proposal to invest 600,000 in new Cell Telephone Product. Production equipment which will be depreciated on a straight-line basis with a 6-year life, and no salvage value. The projected Please help me I will give you the brain thing and extra points. (image below) 2/13 Abby and Alex were practicing free throws. Abby attempted 40 shots and made 36 of them. Alex attempted 60 shots and made 54 of them. Who made a higher percentage of their attempts? PLEASE HELP HELP HELP!!! Describe one trend shown on the bar chart.Describe two factors that enable a president to pass major legislation during his first hundred days in office. Explain one reason why the number of bills passed during the first hundred days in office may not indicate that the president will be successful in passing bills later in his presidency. Question 1 (3 points)Match the compisite figures to it's area.For any composite figures including circles, use 3.14 for \large \piColumn A1.:2.:3.:Column Ba.151 cm squaredb.4846.40 cm squaredc.156 cm squaredd.1,379.84 cm squarede.1,285.64 cm squaredf.114 cm squaredg.Answer not givenh.576 cm squaredi.72 cm squaredj.108 cm squaredk.66 cm squaredQuestion 2 (1 point) a576 sq ft b492 sq ft c472 sq ft d388 sq ftQuestion 3 (4 points)Find the area of the composite figures below.Use 3.14 for \large \piColumn AColumn A1.:2.:3.:4.:Column Ba.91.8 in. squaredb.64 in. squaredc.59.8 in. squaredd.464 in. squarede.99.25 in. squaredf.181.4 in. squaredg.189.25 in. squaredh.96 in. squaredi.228.5 in. squaredj.Answer not given A 10 kg block is attached to a light cord that is wrapped around the pulley of an electric motor, as shown above. If the motor raises the block from the floor to a height of 8.0 meters in 5 seconds what was the motors power output? What is the volume of the toy top pictured below? Steam Workshop Downloader