why does electrolysis in aqueous solution of sodium chloride does not produce sodium as it's cathode ​

Answers

Answer 1

Because water is more quickly reduced than Na+ ions, the sodium metal that results from the electrolysis of aqueous NaCl is replaced at the cathode by hydrogen gas.

Why does sodium not evolve at the cathode during electrolysis of aqueous sodium chloride?

The positively charged salt in NaCl tends to travel towards the negatively charged substance in accordance with the law of attraction. Because the anode acts as a negatively charged diode during electrolysis, sodium moves towards the anode rather than the cathode.

Why does sodium chloride electrolysis fail to yield metallic sodium?

When sodium is created, it immediately interacts with water molecules to create sodium hydroxide. You will therefore receive aqueous solution of sodium hydroxide and hydrogen gas rather than pure sodium metal.

To learn more about electrolysis visit:

brainly.com/question/12054569

#SPJ9


Related Questions

Write the formula of the hemiacetal
product when
CH3-CH₂-CH₂-CH₂-CHO
reacts with CH₂CH₂OH. Also, write the
acetal product.

Answers

When CH3-CH2-CH2-CH2-CHO (butyraldehyde) reacts with CH2CH2OH (ethylene glycol), a hemiacetal is formed.

The reaction can be written as:

CH3-CH2-CH2-CH2-CHO + CH2CH2OH → CH3-CH2-CH(OH)-CH2-CH2OH

The hemiacetal product is CH3-CH2-CH(OH)-CH2-CH2OH.

If the reaction continues, a second molecule of ethylene glycol can react with the hemiacetal to form an acetal:

CH3-CH2-CH(OH)-CH2-CH2OH + CH2CH2OH → CH3-CH2-CH(OC2H4)-CH2-CH2OH + H2O

The acetal product is CH3-CH2-CH(OC2H4)-CH2-CH2OH.

What is a molecule ?

Molecules can exist in different states, including gases, liquids, and solids. The physical and chemical properties of a molecule are determined by the types of atoms it contains, the way the atoms are arranged, and the types of chemical bonds between them. The study of molecules and their properties is an important area of chemistry and plays a crucial role in many areas of science and technology, including materials science, pharmaceuticals, and biochemistry.

To know more about Molecules visit :

https://brainly.com/question/19922822

#SPJ1

ASAP!!!!1. Claim: How are elements arranged on the periodic table in terms of valence
electrons?

Answers

Elements on the periodic table are arranged in order of increasing atomic number.

Arrangement of element in the Periodic table

This means that elements with lower atomic numbers have fewer valence electrons compared to elements with higher atomic numbers.

The elements are arranged into columns, or groups, based on the number of valence electrons they possess.

Elements in the same group generally have the same number of valence electrons, and elements in the same period (row) generally have one more valence electron than the element before it.

Learn more about the Periodic table here:

https://brainly.com/question/1173237

#SPJ1

Balance
Pb(NO3)2 + NaCl PbCl2+ NaNO3

Answers

The balanced chemical equation for the reaction between Pb(NO3)2 and NaCl is:

Pb(NO3)2 + 2NaCl -> PbCl2 + 2NaNO3

In order for a chemical equation to be balanced, the number of atoms of each element in the reactants must be equal to the number of atoms of each element in the products.

In the given equation, there are one Pb atom, two Na atoms, two Cl atoms, two N atoms, and six O atoms on the left-hand side (reactants) of the equation. On the right-hand side (products) of the equation, there are one Pb atom, two Na atoms, two Cl atoms, two N atoms, and six O atoms.

To balance the equation, we need to adjust the coefficients (the numbers in front of the chemical formulas) so that the number of atoms of each element is the same on both sides. In this case, we need to add a coefficient of 2 in front of NaCl on the reactant side to balance the number of Cl atoms, which also adds 2 Na and 2 NO3 atoms. This gives us:

Pb(NO3)2 + 2NaCl -> PbCl2 + 2NaNO3

Now the equation is balanced because there are the same number of atoms of each element on both the reactant and product sides.

Learn more about chemical equation here:

https://brainly.com/question/30087623

#SPJ1

What is the final volume of NaOH solution prepared from 250.0 mL of 0.300 M NaOH if you wanted the final concentration to be 0.150 M ?

Answers

The final volume of the NaOH solution is 500.0 mL.

To prepare a solution with a desired concentration, we can use the formula:

C = n/V

where C is the concentration in units of moles per liter (M), n is the number of moles of solute, and V is the volume of the solution in liters. Rearranging this formula, we get:

n = C x V

This formula tells us that we can find the number of moles of solute we need by multiplying the desired concentration (C) by the desired volume (V) of the solution.

To calculate the final volume of the NaOH solution, we can use the following equation:

M1V1 = M2V2

where M1 and V1 are the initial concentration and volume, respectively, and M2 and V2 are the final concentration and volume, respectively.

Substituting the given values into the equation, we get:

(0.300 M) (250.0 mL) = (0.150 M) (V2)

Solving for V2, we get:

V2 = (0.300 M × 250.0 mL) / (0.150 M)

V2 = 500.0 mL.

Learn more about concentration here:

https://brainly.com/question/10725862

#SPJ1

*I’m confused? Pls help, it’s due tmr*
Modeling Tool: Two Samples at the Atomic Scale
Goal: Create a model that represents a repeating group of atoms that could make up sample 2.

Answers

Based on the given information, it seems like we need help with creating a model of a repeating group of atoms for sample 2 using an atomic scale modeling tool. Here's an answer that includes the terms:

To create a model that represents a repeating group of atoms for sample 2, you should use the modeling tool at the atomic scale. Start by identifying the elements and their arrangement within the sample. Once you have this information, construct the repeating unit of atoms in the modeling tool, ensuring you accurately represent the positions, types, and bonding of the atoms involved. This model will help you visualize and better understand the structure of sample 2 at the atomic level.

For more questions on: scale

https://brainly.com/question/28571689

#SPJ11

Consider the incomplete structure. Add formal charges as necessary to the structure. All unshared valence electrons are shown. Do not alter the structure‑just add charges. If you need to revert the drawing palette to the original state, select the More menu, then select Reset Drawing.

Answers

The net formal charge on the given species ([tex]ClO_4[/tex]) is -1. From the diagram we can see that each oxygen atom has 3 pair of electrons and remaining are shared with the chlorine atom.

A charged species is a species that has an unequal number of protons and electrons, resulting in an overall charge. Examples of charged species include ions, radicals, and polar molecules. Ions are atoms or molecules that have gained or lost one or more electrons, resulting in a net charge while radicals are molecules or ions with an unpaired electron, resulting in a net charge.

Formal charge is calculated as = total number of valence electrons in free atom - number of non-bonding electrons - 1/2 (number of bonding electrons).

Free atom is chlorine with 7 valence electrons.

Oxygen has 8 electrons which are in pairs so, non-bonding electrons = 0

Number of bonding electrons = 14

formal charge on chlorine = 7 - 0 - 1/2(14) = 0

Formal charge on three oxygen atoms = 6 - 4 - 1/2(4) = 0

Formal charge on fourth oxygen atom = 6 - 6 - 1/2(2) = -1

net charge = 0 + 0 + (-1) = -1

To learn more about formal charge click here https://brainly.com/question/11723212

#SPJ1

I have discovered a new compound which I have named MidasEne. It has the ability to magically turn everything that it touches into gold. I am trying to keep the formula proprietary, but you are smart, and you have figured out that my compound has a molar mass of 1,080.54 grams/mol and an empirical formula of C3H4O5. So what is the molecular formula of my secret compound?

Answers

Answer:

molecular formula = C₂₇H₃₆O₄₅

Explanation:

In order to find the molecular formula of a compound from its empirical formula, we need to know the number of "empirical formula units" that are in the molecular formula.

To find the number of empirical formula units, n,  we use the following formula:

[tex]\boxed{\mathrm{n = \frac{molar \ mass}{empirical \ formula \ mass}}}[/tex].

The empirical formula mass is simply the molar mass of the compound that is represented by the empirical formula. Therefore, in this case,

Empirical formula mass of C₃H₄O₅ = (12 × 3) + (1 × 4) + (16 × 5)

                                                         = 36 + 4 + 80

                                                         = 120

Next, we can find the value of n using the above formula:

n = [tex]\frac{1080.54}{120}[/tex]

  = 9.00

Now that we know the number of empirical formula units (n) present in the molecular formula, we simply have to multiply the number of each element present in the empirical formula by n:

Molecular formula = (empirical formula)ₙ

⇒ Molecular formula = (C₃H₄O₅)₉

                                   = C₂₇H₃₆O₄₅

Therefore, the molecular formula of the secret compound is C₂₇H₃₆O₄₅.

how many grams of no gas are there in a 5.00-l cylinder at 4.00 × 103 mm hg and 23°c

Answers

There are 32.1 grams of NO gas in the cylinder if a 5.00-l cylinder at 4.00 × 103 mm hg and 23°c.

To determine the number of grams of NO gas in a 5.00 L cylinder at [tex]4.00 × 10^3[/tex] mmHg and 23°C, we can use the ideal gas law:

PV = nRT

where P is the pressure, V is the volume, n is the number of moles of gas, R is the gas constant, and T is the temperature in Kelvin.

First, we need to convert the pressure to atmospheres and the temperature to Kelvin:

4.00 × [tex]10^3[/tex] mmHg = 5.26 atm (1 atm = 760 mmHg)

23°C = 296 K

Now we can rearrange the ideal gas law to solve for n:

n = PV/RT

n = (5.26 atm)(5.00 L)/(0.0821 L·atm/mol·K)(296 K) = 1.07 mol

Finally, we can convert from moles to grams using the molar mass of NO:

1.07 mol NO × 30.01 g/mol = 32.1 g NO

Therefore, there are 32.1 grams of NO gas in the cylinder.

Learn more about ideal gas law here

https://brainly.com/question/28257995

#SPJ1

Silicon nitride is a very hard, high-temperature-
resistant ceramic used as a component of
turbine blades in jet engines. It is prepared
according to the following equation:
3Si(s) + 2N₂(g) → Si3 N4(S)
Which is the limiting reactant when 2.00 g of Si
and 1.50 g of N₂ react?

Answers

The limiting reactant when 2.00 g of Si and 1.50 g of N₂ react is Silicon (Si).

When two reactive compounds are mixed, then they react according to the stoichiometry of the balanced chemical equation between them. The reactant which is present in excess will be left unreacted after the completion of the reaction whereas the other corresponding reactant will name as the limiting reagent of the reaction.  

The molar mass of Si and N₂ is 28.08 g/mol and 28 g/mol.

The stoichiometry in which Si and N₂ is 3:2.

The mass of Si required to react with 1.50 g of N₂ is calculated as follows:

m(Si) = (3 × 28.08 g) / (2×28 g) × 1.50 g = 2.25 g

Since the calculated mass of Si is more than the given mass. Therefore we can say that Si is a limiting reagent.

Learn more about limiting reagent from the link given below.

https://brainly.com/question/11848702

#SPJ1

What is the average experimental volume per mole of carbon dioxide calculated for sodium carbonate and sodium bicarbonate?

Answers

Answer: 24.356L/mol.

Explanation: Hence, the average experimental volume per mole of carbon dioxide for sodium carbonate and sodium bicarbonate is 24.356L/mol.

write a brief statement that refers to the purpose of the experiment

Purpose: To find Heat of Solution of sodium hydroxide and to find the heat of neutralization between sodium hydroxide and hydrochloric acid, using enthalpy, Qsurr & Qrxn, percent error, etc.

experiment 1 findings:
50mL water
2.00g of sodium hydroxide
T (temp) initial = 20 degrees C
T (temp) final = 28.5 degrees C

experiment 2 findings:
50mL of 0.75 concentration M HCl
T (temp) initial = 23.5 degrees C
T (temp) final = 27 degrees C

Answers

The experiment involved measuring the temperature changes of water and solutions containing sodium hydroxide and hydrochloric acid.

What is HCl?

HCl is the chemical formula for hydrogen chloride, a colorless, highly pungent gas. It is a strong acid that is commonly used in industry for a variety of applications, such as the production of PVC, food processing, and metal cleaning. It is also found naturally in the stomach as a component of gastric acid, where it aids in digestion. In water, HCl dissociates into H+ and Cl- ions, making it a strong electrolyte.

The purpose of the experiment was to determine the heat of solution of sodium hydroxide and the heat of neutralization between sodium hydroxide and hydrochloric acid, using various methods such as enthalpy, Qsurr & Qrxn, percent error, etc.

Learn more about HCl from the given link

https://brainly.com/question/27576431

#SPJ1

You just worked on collecting evidence to answer the Investigation Question: How is something different when it is warmer or cooler? How did the experiment with the cold and warm water change your thinking about the Investigation Question?​

Answers

My experiment with the cold and warm water changed my thinking about the Investigation Question because it showed me that the temperature of something can have a major impact on its properties.

Experiment with cold and warm water

For example, warm water was more buoyant than cold water, which meant that the warmer water was able to float objects that the colder water could not. This showed me that temperature can play a role in the physical properties of an object, making it either lighter or heavier, depending on the temperature.

My experiment with cold and warm water showed me that temperature can have a major effect on physical properties. When comparing cold and warm water, I found that the warmer water was more buoyant and was able to float objects that the colder water could not.

This demonstrated to me how temperature can impact the weight and buoyancy of an object, making it either lighter or heavier depending on the temperature.

Learn more Experiment here:

https://brainly.com/question/17274244

#SPJ1

What is the pH of a solution with an H+ ion concentration of 2.5e-4?

Answers

Answer: pH=-log[H+]

pH=-log(2.5x10^-4)

pH=3.6

Explanation:

At STP, how many moles of helium gas would occupy 60 L?

Answers

Answer:

At STP (standard temperature and pressure), one mole of any gas occupies 22.4 liters. Therefore, to determine the number of moles of helium gas that would occupy 60 L at STP, we can use the following conversion factor:

1 mole He gas = 22.4 L He gas at STP

So, we can set up the following proportion:

x moles He gas / 60 L He gas = 1 mole He gas / 22.4 L He gas

where x is the number of moles of helium gas we want to find.

To solve for x, we can cross-multiply and simplify:

x moles He gas = (60 L He gas)(1 mole He gas / 22.4 L He gas)

x moles He gas = 2.68 moles He gas (rounded to two decimal places)

Therefore, 2.68 moles of helium gas would occupy 60 L at STP.

SrBr2 + (NH4)2CO3
→ SrCO3 + NH4Br

Is this balanced? And if not how do I balance it?

Answers

Answer: No the equation is not balanced

Explanation:

Here's how to balance it:

SrBr2 + (NH4)2CO3 → SrCO3 + 2NH4Br

The balanced equation has 1 strontium atom, 2 bromine atoms, 1 carbon atom, 3 oxygen atoms, 4 hydrogen atoms, and 2 ammonium ions on both sides of the equation.

Answer:

No, the given equation is not balanced. The balanced equation is:

SrBr₂ + (NH₄)₂CO₃ → SrCO₃ + 2NH₄Br

Explanation:

A chemical equation is a representation of a chemical reaction using chemical formulas and symbols. It shows the reactant(s) on the left side of the equation and the product(s) on the right side of the equation, separated by an arrow that indicates the direction of the reaction.

[tex]\underbrace{\sf SrBr_2 + (NH_4)_2CO_3} \;\;\longrightarrow \;\;\underbrace{\sf SrCO_3 + NH_4Br}\\\sf \phantom{ww.w}Rectant(s) \qquad \qquad \quad \quad Product(s)[/tex]

A balanced chemical equation has the same number of atoms of each element on both sides of the equation.

Coefficients are used to balance chemical equations and are placed in front of a chemical symbol or formula where needed.

Given chemical equation:

[tex]\sf SrBr_2 + (NH_4)_2CO_3 \;\;\longrightarrow \;\; SrCO_3 + NH_4Br[/tex]

Here, we need to balance the number of Sr, Br, N, H, C, and O atoms.

Check to see if there are the same number of atoms of each element on both sides of the equation:

[tex]\begin{array}{|l|c|c|c|c|c|c|}\cline{1-7}\vphantom{\dfrac12}\sf &Sr&Br&N&H&C&O\\\cline{1-7}\vphantom{\dfrac12}\sf Reactant&1&2&2&8&1&3\\\cline{1-7}\vphantom{\dfrac12}\sf Product&1&1&1&4&1&3\\\cline{1-7}\end{array}[/tex]

We can see that there are two bromine atoms on the left but only one on the right, so a coefficient of 2 needs to be added to NH₄Br on the right side of the equation:

[tex]\sf SrBr_2 + (NH_4)_2CO_3 \;\;\longrightarrow \;\; SrCO_3 + 2NH_4Br[/tex]

By adding the coefficient 2 to NH₄Br on the right side of the equation, the number of N, H and Br atoms on this side have been multiplied by 2. So we now have:

[tex]\begin{array}{|l|c|c|c|c|c|c|}\cline{1-7}\vphantom{\dfrac12}\sf &Sr&Br&N&H&C&O\\\cline{1-7}\vphantom{\dfrac12}\sf Reactant&1&2&2&8&1&3\\\cline{1-7}\vphantom{\dfrac12}\sf Product&1&2&2&8&1&3\\\cline{1-7}\end{array}[/tex]

As there are now the same number of atoms of each element on both sides of the equation, it is balanced.

Therefore, the balanced chemical equation is:

[tex]\sf SrBr_2 + (NH_4)_2CO_3 \;\;\longrightarrow \;\; SrCO_3 + 2NH_4Br[/tex]

6. Which substance is soluble in water?
A. Pb(CO3)2
B. Ag3PO4
C. Sn(CrO4)2
D. NH4CI

Answers

Substance is soluble in water is D. NH₄CI. Soluble in water means that is capable of dissolving in water.

What does soluble in water mean?

Substance is soluble if it dissolves in certain fluids and the fluid [gas or liquid] (present in excess) is called solvent and substance dissolved in it is called solute which together forms solution. Process of dissolving is called the solvation.

If substance is soluble, then it implies that it can be dissolved in liquid. This means particles are broken down to become so small that we can no longer see them. Salt and sugar are examples of soluble materials. Opposite of soluble is insoluble ( that is a substance that cannot be dissolved).

To know more about soluble, refer

https://brainly.com/question/23946616

#SPJ1

Round your answer to the nearest hundredth.
A right triangle A B C. Angle A C B is a right angle. Angle A B C is twenty degrees. Side B C is unknown. Side A C is four units.

Answers

The length of the side BC in the right triangle is 3.76 units.

How to find the length of side BC?

We want to find the length of the side BC, for the right triangle ABC.

We know that:

ACB = 90°

ABC = 20°

AC = 4 units.

Now we need to use trigonometric relations to find BC, we can use the relation:

cos(a) = adjacent cathetus/hypotenuse

Replacing what we know we will get:

cos(20°) =BC/4

4*cos(20°) = BC = 3.76

That is the length.

Learn more about right triangles at:

https://brainly.com/question/2217700

#SPJ1

to lower the impacts of climate change we can do the following activities:

1
2
3
4
5
science plss help

Answers

Answer:

1. Know your carbon footprint.

2. Travel less.

3. Eat less meat and focus on sustainably grown meat.

4. Create less waste.

5. Recycle more and create less trash.

Need help with problem

Answers

The number of moles of CO in the given conditions is 2.51 moles. To calculate the number of moles of CO in the given conditions, we need to use the Ideal Gas Law equation:

PV = nRT

Where:

P = pressure

V = volume

n = number of moles

R = gas constant

T = temperature

First, we need to convert the given temperature in Celsius to Kelvin by adding 273.15:

T = 93°C + 273.15 = 366.15 K

Now we can plug in the values we have:

P = 4.52 atm

V = 20.0 L

R = 0.0821 L.atm/mol.K (gas constant for CO)

T = 366.15 K

n = PV/RT = (4.52 atm x 20.0 L)/(0.0821 L.atm/mol.K x 366.15 K) = 2.51 moles

Therefore, the number of moles of CO in the given conditions is 2.51 moles.

To know more about Ideal Gas Law, visit:

https://brainly.com/question/28257995

#SPJ1

ASAP PLEASE!!!2. Evidence: Use the Element symbol provided to create a Bohr/ Orbital Model for
each. Use the PhET simulation to work through each. Complete the table below.
Include a picture of each that you either snip from the simulation or draw. Include the
I
Physical Science B 11-1C Lab Periodic Trends
information to complete the last 3 columns. Use the simulation for subatomic particles
and location. Use the periodic table to determine if it is a metal, nonmetal or metalloid.
The highlighted boxes have been done for you as examples.
(4 points)

Answers

Be is a metalB is a metalloidC is a non metal.

How do you know metal, nonmetal or metalloid in the periodic table?

Metals are typically solid at room temperature, have a shiny or metallic appearance, are good conductors of heat and electricity, and are malleable and ductile.

Nonmetals, on the other hand, can exist in all three states of matter at room temperature, are generally not shiny, and are poor conductors of heat and electricity. They tend to be brittle and cannot be easily drawn into wires or hammered into thin sheets.

Metalloids have properties that fall somewhere between those of metals and nonmetals. They may have a shiny or dull appearance, and their ability to conduct heat and electricity is generally between that of metals and nonmetals.

The position of an element in the periodic table can give you some clues about its classification. Metals are typically found on the left side and middle of the periodic table, nonmetals are found on the right side, and metalloids are located along the "stair-step" line that separates the metals and nonmetals.

Learn more about periodic table:https://brainly.com/question/11155928

#SPJ1

Aspirin is produced by the reaction of salicylic acid (M = 138.1 g/mol) and acetic anhydride (M = 102.1 g/mol).
C7H6O3(s) + C4H6O3() → C9H8O4(s) + C2H4O2()
If the theoritical yield of aspirin is 3.95 g and the actual yield is 2.04 g what is the percent yield?

Answers

The percent yield of aspirin is 51.6%.

What is the theoretical yield of aspirin in grams, given the reaction produced 10.0 g of salicylic acid and 5.0 g of acetic anhydride?

The limiting reagent is salicylic acid, and the theoretical yield of aspirin is 12.2 g.

If the actual yield of aspirin in the above scenario is 8.9 g, what is the percent yield?

The percent yield of aspirin is 72.9%.

The theoretical yield of aspirin is 3.95 g, but the actual yield is 2.04 g.

The percent yield can be calculated using the formula:

percent yield = (actual yield / theoretical yield) x 100%

Substituting the values given in the question, we get:

percent yield = (2.04 g / 3.95 g) x 100%

percent yield = 51.6%

Learn more about aspirin here:

https://brainly.com/question/13494090

#SPJ1

Calculate the final volume of a baloon If It has a volume of 2.0L and pressure of 2 atmosphere and the pressure is reduced to I atmospher 1,Assume temperature remains​

Answers

Answer: 4 L

Explanation:

Boyle's law states that [tex]P_1V_1=P_2V_2[/tex]

Since no values other than pressure and volume change, we will use this equation.

Given in the problem we know:

[tex]P_1=2\\V_1=2.0\\P_2=1[/tex]

So, we are left with one variable to solve for.

[tex]2*2.0=1*V_2\\V_2=4 L[/tex]

A doctor orders 7 mg of compazine, which is used to treat nausea, vertigo, and migraine headaches. If the stock solution is 2.5 % (m/v), how many milliliters are administered to the patient?

Answers

To solve the problem, we need to use the following formula:

Amount (in mg) = concentration (in %) x volume (in mL) x density (in g/mL)

First, we need to convert the percentage concentration to a decimal:

2.5% = 0.025

Next, we can rearrange the formula to solve for volume:

Volume (in mL) = Amount (in mg) / (concentration (in %) x density (in g/mL))

The density of compazine is approximately 1 g/mL.

So, plugging in the given values, we get:

Volume (in mL) = 7 mg / (0.025 x 1 g/mL) = 280 mL

Therefore, 280 mL of the compazine solution should be administered to the patient.

Give the conjugate acid of the following Bronsted-Lowry bases. (Type your answer using the format [OH]- for OH -.)

What is the conjugate acid of C7H5O2-

Answers

Answer:

The conjugate acid of a Bronsted-Lowry base is the species formed when it accepts a proton (H+).

C7H5O2- is a base because it can accept a proton to form its conjugate acid. To find the conjugate acid of C7H5O2-, we add a proton to it. The proton will bond with one of the oxygen atoms, and the resulting species will be:

C7H5O2H

Therefore, the conjugate acid of C7H5O2- is C7H5O2H.

How many bromine atoms are present 35.2 g of CH2Br2?
Can someone explain how to get answers with steps.

Answers

Answer:

There are approximately 2.448 x 10^23 bromine atoms present in 35.2 g of CH2Br2.

Explanation:

The molar mass of CH2Br2 can be calculated as follows:

Molar mass of C = 12.01 g/mol

Molar mass of H = 1.01 g/mol

Molar mass of 2 Br = 2 x 79.90 g/mol = 159.80 g/mol

Therefore, the molar mass of CH2Br2 = 12.01 + 1.01 + 159.80 = 172.82 g/mol

Next, we can calculate the number of moles of CH2Br2 as follows:

moles of CH2Br2 = mass of CH2Br2 / molar mass of CH2Br2

moles of CH2Br2 = 35.2 g / 172.82 g/mol

moles of CH2Br2 = 0.203 moles

Finally, we can use Avogadro's number to calculate the number of bromine atoms present:

Number of bromine atoms = moles of CH2Br2 x 2 (since there are 2 bromine atoms per molecule of CH2Br2) x Avogadro's number

Number of bromine atoms = 0.203 x 2 x 6.022 x 10^23

Number of bromine atoms = 2.448 x 10^23 bromine atoms

Therefore, there are approximately 2.448 x 10^23 bromine atoms present in 35.2 g of CH2Br2.

Drag each label to the correct location on the chart.
Sort the activities based on whether they decrease or maintain biodiversity.
planting more trees
excessive mining to
obtain minerals
releasing sewage
water into lakes
prohibiting fishing
during breeding
season
Reset Next

Answers

Reduce biodiversity: dumping sewage water into lakes as a result of excessive mining for minerals. Increase tree planting and ban fishing during the mating season to preserve biodiversity.

What steps may be taken to preserve biodiversity?

Encourage regional and local initiatives to combat biodiversity loss and promote its prevention. acquiring fewer products while ensuring that the ones you do purchase have a minimal impact on biodiversity. Investing in initiatives to advance biodiversity. Reducing waste of consumer products, including food, clothing, electrical equipment, and others can help to prevent the loss of biodiversity.

What examples of biodiversity are there?

The majority of people understand biodiversity as a collection of distinct living things that are capable of breeding with one another. Examples of species include white-tailed deer, blue whales, sunflowers, white pine trees, and microscopic germs that are so small they cannot even be seen with the human eye.

To learn more about biodiversity visit:

brainly.com/question/13073382

#SPJ1

If you are given 5 moles of NaNO, how many moles of HNO, would be produced?​

Answers

5 Moles of HNO₂ is produced from 5 moles of NaNO. This is taken out by molar reaction and stochiometric coefficients .

What are moles ?

A mole, like all units, must be defined or founded on something reproducible. The mole's current definition is defined, but it was previously based on the amount of atoms in a sample of the isotope carbon-12. A mole is now defined as Avogadro's number of elements, which is 6.02214076 × 10²³. For all practical purposes, one mole of a compound in grams is roughly equivalent to one molecule of the compound in Daltons.

Originally, a mole was defined as the amount of anything that contains the same number of elements as 12.000 grams of carbon-12. That number of elements is known as Avogadro's Number, which is approximately 6.02x10²³. 6.02x10²³carbon atoms constitute a mole.

Since the reaction of NaNO and HNO₂ is a 1:1 ratio, 5 moles of NaNO would produce 5 moles of HNO₂.

NaNO + HNO₂ → NaNO₂

The balanced equation for the reaction is:

2 NaNO + HNO₂ → 2 NaNO2

Therefore, if you start with 5 moles of NaNO, 5 moles of HNO₂ will be produced.

To know more about mole , visit ;

brainly.com/question/26416088

#SPJ1

A 5.00-L tank contains helium gas at 1.50 atm. What is the pressure of the gas when the volume increased to 4.5atm?

Answers

Answer:

the pressure of the gas is 1.67 atm when the volume increased to 4.5 L.

Explanation:

Assuming the temperature and the amount of gas remain constant (i.e., the process is isobaric):

Using Boyle's law, we can relate the initial pressure (P1) and volume (V1) to the final pressure (P2) and volume (V2):

P1V1 = P2V2

Plugging in the given values:

P1 = 1.50 atm

V1 = 5.00 L

V2 = 4.5 L

Solving for P2:

P2 = (P1V1)/V2 = (1.50 atm x 5.00 L)/4.5 L = 1.67 atm

We wish to determine the moles of carbon dioxide
produced when 50.0 mL of 2.0 M hydrochloric
acid reacts with excess sodium carbonate.
2HCl(aq) + Na₂CO3(aq) → 2NaCl(aq) + H₂O(1) + CO₂(g)
->
In the previous step, you determined
0.10 mol HCI react.
How many moles of carbon dioxide form during
the reaction?
Moles CO₂
Enter

Answers

Answer: .05

Explanation:

what is parallax errors sometimes called​

Answers

Answer: They are sometimes called sighting errors

Explanation:

Other Questions
in what fundamental respect does electromagnetism break away from the form of materialism associated with the physics of newton and democritus? group of answer choices the electromagnetic force can be felt across a vacuum. newton had thought that the only force in the universe was gravity. the electromagnetic field is physically real, even though it is not made of atoms. nonsense--electromagnetism agrees quite well with newtonian materialism. electromagnetism implies that the future cannot be precisely determined. The following data are taken from the income statement columns of the worksheet of a merchandising business prepared for the year ended December 31, 2002. Net Income Br. 12,500 Sales 45,000 Income Summary 10,000 Dr. and 6,000 Cr. Gross Purchase 19,750 Purchase Ret. & Allowances 200 Purchase Discount 50 BASED ON THE DATA GIVEN ABOVE ANSWER QUESTIONS 7-9 7. What is the total cost of goods sold for the year? an all-equity firm had a dividend expense of $30,000 last year. the market value of the firm is $900,000 and the dividend is expected to increase at 6% each year. what is the cost of equity for this firm? Which is a property of every heterogeneous mixture? a.the mixture is made up of at least two different states. b.the mixture is made up of something dissolved in a liquid. c.the composition of the mixture is the same throughout. d.the characteristics of the mixture change within a sample. hana fills a cup with sandy ocean water. she pours the mixture through a filter. what does she collect that passes through the filter? a.a sample of pure water b.a solution of salt in water c.a suspension of sand in water d.a colloid of salt in water which describe colloids? check all that apply. 1.heterogeneous mixtures 2.homogeneous mixtures 3.may have a uniform appearance 4.are made up of at least two substances 5.will settle out over time when mixed, which states of matter form only a homogeneous mixture? a.two liquids b.two gases c.a solid and A dnde se dirige el tren?al centro de la ciudada una estacina otra ciudada la casa de esta persona Find thenonpermissible replacment for x in this expression b^2/-7b+7 Read the haiku. aprils air stirs in willow-leaves . . . a butterfly floats and balances now, read gabriels analysis of the haiku. this haiku contains a kigo in addition to a motif. which word from the haiku supports gabriels analysis? a. aprils b. willow-leaves c. butterfly d. balances Considering the results from part a it follows that the volume of a cylinder can be found in the same way as the volume of a rectangular prism. Use your results in what you know about volume to explain how to find the volume of a cylinder with a base radius of r units and a height of h units. a nurse is beginning to use patient-centered care and cultural competence to improve nursing care. which step should the nurse take first? ASAP!!!!1. Claim: How are elements arranged on the periodic table in terms of valenceelectrons? What is one way the author creates tension in the passage?The passage begins in the present, then shifts to the past, and then concludes in the present.The narrator is a complex character, but the other characters in the passage are flat.The pace of narration remains the same throughout the passage.The narrator's descriptions do not seem truthful. Problems 9 & 10. Determine whether the triangles are similar by AA~, SSS~, SAS~, or not similar. If the triangles are similar, write a valid similarity statement. Part B: Which quote best supports the answer to Part A? A. "As for adopting the ways which the State hasprovided for remedying this evil, I know not of such ways." (Paragraph 7) B. "Men generally, under such a government as this, think that they ought to wait until they have persuaded the majority to alter them. (Paragraph 4)0C. "They take too much time, and a man's life will be gone." (Paragraph 7)D."Those who, while they disapprove of the character and measures of a government, yield to it their allegiance and support are undoubtedly its most ryan is a 25% partner in the rocc partnership. at the beginning of the tax year, his basis in the partnership interest was $90,000, including his share of partnership liabilities. during the current year, rocc reported net ordinary income of $100,000. in addition, rocc distributed $10,000 to each of the partners ($40,000 total). at the end of the year, ryan's share of partnership liabilities increased by $10,000. his basis in the partnership interest at the end of the year is: Negative effects of globalization in an undeveloped country? Aspirin is produced by the reaction of salicylic acid (M = 138.1 g/mol) and acetic anhydride (M = 102.1 g/mol).C7H6O3(s) + C4H6O3() C9H8O4(s) + C2H4O2()If the theoritical yield of aspirin is 3.95 g and the actual yield is 2.04 g what is the percent yield? Which statements describe a result of Gitlow v. New York? Check all that apply. Through incorporation, the First Amendment applied to state law. Constitutional amendments cannot be incorporated as needed. The Fourteenth Amendment made the Constitution superior to state law. The states are not responsible for following the Bill of Rights. The due process clause can be used to incorporate the Bill of Rights. are organisms that oxidize inorganic molecules for energy generation a. hetertrophs b. autotrophs c. organotrophs od. chemolithotrophs Two small local dog shows record the weight of each dog (to the nearest pound) entering the competition. The data are presented in the box plots.Which is a valid inference based on the box plots shown? Choose all that apply.AThe weights in Dog Show 1 are less variable than the weightsin Dog Show 2.BThe range of weights in Dog Show 1 is greater than the range of weightsin Dog Show 2.CThe interquartile range for Dog Show 1 is less than the interquartile rangefor Dog Show 2.DFewer dogs are entered in Dog Show 1 than in Dog Show 2.EThe median weight in Dog Show 1 is lower than the median weight in Dog Show 2. can you solve this question?f'(x)=? Steam Workshop Downloader